1IT

?

Summary

Name:DIBENZOFURAN
Formula:C12 H8 O
Formal charge:0
Molecular weight:168.191 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs12.01dibenzo[b,d]furan
OpenEye OEToolkits1.7.0dibenzofuran

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01o2c1ccccc1c3c2cccc3
SMILES_CANONICALCACTVS3.370o1c2ccccc2c3ccccc13
SMILESCACTVS3.370o1c2ccccc2c3ccccc13
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc2c(c1)c3ccccc3o2
SMILESOpenEye OEToolkits1.7.0c1ccc2c(c1)c3ccccc3o2
InChIInChI1.03InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H
InChIKeyInChI1.03TXCDCPKCNAJMEE-UHFFFAOYSA-N
167132
PDB entries from 2020-07-29