06Y

?

Summary

Name:2-phenoxyethanoic acid
Formula:C8 H8 O3
Formal charge:0
Molecular weight:152.147 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01phenoxyacetic acid
OpenEye OEToolkits1.7.22-phenoxyethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)COc1ccccc1
InChIInChI1.03InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)
InChIKeyInChI1.03LCPDWSOZIOUXRV-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370OC(=O)COc1ccccc1
SMILESCACTVS3.370OC(=O)COc1ccccc1
SMILES_CANONICALOpenEye OEToolkits1.7.2c1ccc(cc1)OCC(=O)O
SMILESOpenEye OEToolkits1.7.2c1ccc(cc1)OCC(=O)O