03V

?

Summary

Name:naphthalen-2-ol
Synonyms:2-Naphtol
Formula:C10 H8 O
Formal charge:0
Molecular weight:144.17 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01naphthalen-2-ol
OpenEye OEToolkits1.7.2naphthalen-2-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01Oc2ccc1c(cccc1)c2
InChIInChI1.03InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H
InChIKeyInChI1.03JWAZRIHNYRIHIV-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.370Oc1ccc2ccccc2c1
SMILESCACTVS3.370Oc1ccc2ccccc2c1
SMILES_CANONICALOpenEye OEToolkits1.7.2c1ccc2cc(ccc2c1)O
SMILESOpenEye OEToolkits1.7.2c1ccc2cc(ccc2c1)O
167327
PDB entries from 2020-08-05